C15H18F2N2O2 — CID 146453946
2-[(2-butyl-1,3-benzoxazol-6-yl)oxy-difluoromethyl]prop-2-en-1-amine (PubChem CID 146453946) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[(2-butyl-1,3-benzoxazol-6-yl)oxy-difluoromethyl]prop-2-en-1-amine.
| Compound Name | 2-[(2-butyl-1,3-benzoxazol-6-yl)oxy-difluoromethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 146453946 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[(2-butyl-1,3-benzoxazol-6-yl)oxy-difluoromethyl]prop-2-en-1-amine |
| SMILES | C=C(CN)C(F)(F)Oc1ccc2nc(CCCC)oc2c1 |
| InChI | InChI=1S/C15H18F2N2O2/c1-3-4-5-14-19-12-7-6-11(8-13(12)20-14)21-15(16,17)10(2)9-18/h6-8H,2-5,9,18H2,1H3 |
| InChIKey | YYXDGWQSTZQNFE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|