C25H30FN3O5S — CID 146454003
[(E)-1-amino-3-fluoro-2-[[2-[(4R)-2,2,4-trimethylpyrrolidin-1-yl]-1,3-benzoxazol-6-yl]oxymethyl]prop-2-enyl] 4-methylbenzenesulfonate (PubChem CID 146454003) has the molecular formula C25H30FN3O5S and a molecular weight of 503.60 g/mol. Its IUPAC name is [(E)-1-amino-3-fluoro-2-[[2-[(4R)-2,2,4-trimethylpyrrolidin-1-yl]-1,3-benzoxazol-6-yl]oxymethyl]prop-2-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-1-amino-3-fluoro-2-[[2-[(4R)-2,2,4-trimethylpyrrolidin-1-yl]-1,3-benzoxazol-6-yl]oxymethyl]prop-2-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 146454003 |
| Molecular Formula | C25H30FN3O5S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [(E)-1-amino-3-fluoro-2-[[2-[(4R)-2,2,4-trimethylpyrrolidin-1-yl]-1,3-benzoxazol-6-yl]oxymethyl]prop-2-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(N)/C(=C/F)COc2ccc3nc(N4C[C@H](C)CC4(C)C)oc3c2)cc1 |
| InChI | InChI=1S/C25H30FN3O5S/c1-16-5-8-20(9-6-16)35(30,31)34-23(27)18(13-26)15-32-19-7-10-21-22(11-19)33-24(28-21)29-14-17(2)12-25(29,3)4/h5-11,13,17,23H,12,14-15,27H2,1-4H3/b18-13+/t17-,23?/m1/s1 |
| InChIKey | RWMKORVFHZLWBX-KGHWZSNCSA-N |
| XLogP | 4.68 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|