C11H12N2O3 — CID 146454135
2-morpholin-4-yl-1,3-benzoxazol-6-ol (PubChem CID 146454135) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,3-benzoxazol-6-ol.
| Compound Name | 2-morpholin-4-yl-1,3-benzoxazol-6-ol |
|---|---|
| PubChem CID | 146454135 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-morpholin-4-yl-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc2nc(N3CCOCC3)oc2c1 |
| InChI | InChI=1S/C11H12N2O3/c14-8-1-2-9-10(7-8)16-11(12-9)13-3-5-15-6-4-13/h1-2,7,14H,3-6H2 |
| InChIKey | MKZICKYFLVYGNI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |