About 2-morpholin-4-yl-1,3-benzoxazol-6-ol
2-morpholin-4-yl-1,3-benzoxazol-6-ol (PubChem CID 146454135) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-morpholin-4-yl-1,3-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 2-morpholin-4-yl-1,3-benzoxazol-6-ol |
| PubChem CID | 146454135 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-morpholin-4-yl-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc2nc(N3CCOCC3)oc2c1 |
| InChI | InChI=1S/C11H12N2O3/c14-8-1-2-9-10(7-8)16-11(12-9)13-3-5-15-6-4-13/h1-2,7,14H,3-6H2 |
| InChIKey | MKZICKYFLVYGNI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-yl-1,3-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-yl-1,3-benzoxazol-6-ol?
The IUPAC name of 2-morpholin-4-yl-1,3-benzoxazol-6-ol (CID 146454135) is 2-morpholin-4-yl-1,3-benzoxazol-6-ol.
What is the SMILES notation for 2-morpholin-4-yl-1,3-benzoxazol-6-ol?
The canonical SMILES for 2-morpholin-4-yl-1,3-benzoxazol-6-ol is Oc1ccc2nc(N3CCOCC3)oc2c1.
What is the InChIKey of 2-morpholin-4-yl-1,3-benzoxazol-6-ol?
The InChIKey is MKZICKYFLVYGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c14-8-1-2-9-10(7-8)16-11(12-9)13-3-5-15-6-4-13/h1-2,7,14H,3-6H2.
What are the key properties of 2-morpholin-4-yl-1,3-benzoxazol-6-ol?
2-morpholin-4-yl-1,3-benzoxazol-6-ol has a molecular weight of 220.23 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-yl-1,3-benzoxazol-6-ol is sourced from PubChem (CID 146454135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).