C26H22F2N4O — CID 146454772
[(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone (PubChem CID 146454772) has the molecular formula C26H22F2N4O and a molecular weight of 444.49 g/mol. Its IUPAC name is [(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone.
| Compound Name | [(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 146454772 |
| Molecular Formula | C26H22F2N4O |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | [(1S,8R)-5-(3,5-difluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
| SMILES | Cn1nc2c(c1-c1cc(F)cc(F)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H22F2N4O/c1-31-25(17-11-18(27)13-19(28)12-17)21-14-20-5-2-6-23(24(21)30-31)32(20)26(33)16-7-8-22-15(10-16)4-3-9-29-22/h3-4,7-13,20,23H,2,5-6,14H2,1H3/t20-,23+/m1/s1 |
| InChIKey | PUMUSGNPLSGQMY-OFNKIYASSA-N |
| XLogP | 5.21 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |