C24H23FN6O — CID 146454775
[(1S,8R)-5-(4-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone (PubChem CID 146454775) has the molecular formula C24H23FN6O and a molecular weight of 430.49 g/mol. Its IUPAC name is [(1S,8R)-5-(4-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone.
| Compound Name | [(1S,8R)-5-(4-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 146454775 |
| Molecular Formula | C24H23FN6O |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [(1S,8R)-5-(4-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-methylpyrazolo[5,4-b]pyridin-3-yl)methanone |
| SMILES | Cn1nc2c(c1-c1ccc(F)cc1)C[C@H]1CCC[C@@H]2N1C(=O)c1nn(C)c2ncccc12 |
| InChI | InChI=1S/C24H23FN6O/c1-29-22(14-8-10-15(25)11-9-14)18-13-16-5-3-7-19(20(18)27-29)31(16)24(32)21-17-6-4-12-26-23(17)30(2)28-21/h4,6,8-12,16,19H,3,5,7,13H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | NTPNYAVQORVLOL-APWZRJJASA-N |
| XLogP | 3.80 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |