C25H23ClN6O — CID 146454930
[(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 146454930) has the molecular formula C25H23ClN6O and a molecular weight of 458.95 g/mol. Its IUPAC name is [(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 146454930 |
| Molecular Formula | C25H23ClN6O |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | [(1S,8R)-5-(3-chlorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[3-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | Cn1nc2c(c1-c1cccc(Cl)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1cccc(-n2cncn2)c1 |
| InChI | InChI=1S/C25H23ClN6O/c1-30-24(16-5-2-7-18(26)11-16)21-13-20-9-4-10-22(23(21)29-30)32(20)25(33)17-6-3-8-19(12-17)31-15-27-14-28-31/h2-3,5-8,11-12,14-15,20,22H,4,9-10,13H2,1H3/t20-,22+/m1/s1 |
| InChIKey | UCWVSSSHPOULGQ-IRLDBZIGSA-N |
| XLogP | 4.61 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |