C26H20F6N6O — CID 146454961
[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-[4-(trifluoromethyl)triazol-1-yl]phenyl]methanone (PubChem CID 146454961) has the molecular formula C26H20F6N6O and a molecular weight of 546.48 g/mol. Its IUPAC name is [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-[4-(trifluoromethyl)triazol-1-yl]phenyl]methanone.
| Compound Name | [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-[4-(trifluoromethyl)triazol-1-yl]phenyl]methanone |
|---|---|
| PubChem CID | 146454961 |
| Molecular Formula | C26H20F6N6O |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | [(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-[2-[4-(trifluoromethyl)triazol-1-yl]phenyl]methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1ccccc1-n1cc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C26H20F6N6O/c1-36-24(13-9-17(27)22(29)18(28)10-13)16-11-14-5-4-8-20(23(16)34-36)38(14)25(39)15-6-2-3-7-19(15)37-12-21(33-35-37)26(30,31)32/h2-3,6-7,9-10,12,14,20H,4-5,8,11H2,1H3/t14-,20+/m1/s1 |
| InChIKey | HQWPFJSNYLWTAJ-VLIAUNLRSA-N |
| XLogP | 5.40 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|