C17H19F2N3O — CID 146454978
(1S,8R)-5-(3,4-difluoro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene (PubChem CID 146454978) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is (1S,8R)-5-(3,4-difluoro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene.
| Compound Name | (1S,8R)-5-(3,4-difluoro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene |
|---|---|
| PubChem CID | 146454978 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (1S,8R)-5-(3,4-difluoro-5-methoxyphenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-diene |
| SMILES | COc1cc(-c2c3c(nn2C)[C@@H]2CCC[C@H](C3)N2)cc(F)c1F |
| InChI | InChI=1S/C17H19F2N3O/c1-22-17(9-6-12(18)15(19)14(7-9)23-2)11-8-10-4-3-5-13(20-10)16(11)21-22/h6-7,10,13,20H,3-5,8H2,1-2H3/t10-,13+/m1/s1 |
| InChIKey | SOYPCWVQLIDBSY-MFKMUULPSA-N |
| XLogP | 3.11 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |