C28H25FN4O — CID 146455171
[(1S,8R)-4-cyclopropyl-5-(3-fluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone (PubChem CID 146455171) has the molecular formula C28H25FN4O and a molecular weight of 452.53 g/mol. Its IUPAC name is [(1S,8R)-4-cyclopropyl-5-(3-fluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone.
| Compound Name | [(1S,8R)-4-cyclopropyl-5-(3-fluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 146455171 |
| Molecular Formula | C28H25FN4O |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [(1S,8R)-4-cyclopropyl-5-(3-fluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
| SMILES | O=C(c1ccc2ncccc2c1)N1[C@@H]2CCC[C@H]1c1nn(C3CC3)c(-c3cccc(F)c3)c1C2 |
| InChI | InChI=1S/C28H25FN4O/c29-20-6-1-4-18(15-20)27-23-16-22-7-2-8-25(26(23)31-33(27)21-10-11-21)32(22)28(34)19-9-12-24-17(14-19)5-3-13-30-24/h1,3-6,9,12-15,21-22,25H,2,7-8,10-11,16H2/t22-,25+/m1/s1 |
| InChIKey | ZKCOGWDAZHCDSI-RDGATRHJSA-N |
| XLogP | 5.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |