C26H23FN4O — CID 146455221
[(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone (PubChem CID 146455221) has the molecular formula C26H23FN4O and a molecular weight of 426.50 g/mol. Its IUPAC name is [(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone.
| Compound Name | [(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 146455221 |
| Molecular Formula | C26H23FN4O |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-quinolin-6-ylmethanone |
| SMILES | Cn1nc2c(c1-c1cccc(F)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H23FN4O/c1-30-25(17-5-2-7-19(27)14-17)21-15-20-8-3-9-23(24(21)29-30)31(20)26(32)18-10-11-22-16(13-18)6-4-12-28-22/h2,4-7,10-14,20,23H,3,8-9,15H2,1H3/t20-,23+/m1/s1 |
| InChIKey | XDVYLRGGKQYXSW-OFNKIYASSA-N |
| XLogP | 5.07 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |