C25H22F3N5O2 — CID 146455278
(6-methoxypyrazolo[1,5-a]pyridin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone (PubChem CID 146455278) has the molecular formula C25H22F3N5O2 and a molecular weight of 481.48 g/mol. Its IUPAC name is (6-methoxypyrazolo[1,5-a]pyridin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone.
| Compound Name | (6-methoxypyrazolo[1,5-a]pyridin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
|---|---|
| PubChem CID | 146455278 |
| Molecular Formula | C25H22F3N5O2 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (6-methoxypyrazolo[1,5-a]pyridin-3-yl)-[(1S,8R)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]methanone |
| SMILES | COc1ccc2c(C(=O)N3[C@@H]4CCC[C@H]3c3nn(C)c(-c5cc(F)c(F)c(F)c5)c3C4)cnn2c1 |
| InChI | InChI=1S/C25H22F3N5O2/c1-31-24(13-8-18(26)22(28)19(27)9-13)16-10-14-4-3-5-21(23(16)30-31)33(14)25(34)17-11-29-32-12-15(35-2)6-7-20(17)32/h6-9,11-12,14,21H,3-5,10H2,1-2H3/t14-,21+/m1/s1 |
| InChIKey | HHLUQRDNNRCZML-SZNDQCEHSA-N |
| XLogP | 4.45 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|