About 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol
3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol (PubChem CID 146455664) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol.
Molecular Properties
| Compound Name | 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol |
| PubChem CID | 146455664 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol |
| SMILES | CCCCOc1ccc(-c2ncncn2)c(O)c1C |
| InChI | InChI=1S/C14H17N3O2/c1-3-4-7-19-12-6-5-11(13(18)10(12)2)14-16-8-15-9-17-14/h5-6,8-9,18H,3-4,7H2,1-2H3 |
| InChIKey | ORJHLUZMEJABTR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol?
The IUPAC name of 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol (CID 146455664) is 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol.
What is the SMILES notation for 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol?
The canonical SMILES for 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol is CCCCOc1ccc(-c2ncncn2)c(O)c1C.
What is the InChIKey of 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol?
The InChIKey is ORJHLUZMEJABTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-3-4-7-19-12-6-5-11(13(18)10(12)2)14-16-8-15-9-17-14/h5-6,8-9,18H,3-4,7H2,1-2H3.
What are the key properties of 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol?
3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol has a molecular weight of 259.31 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-2-methyl-6-(1,3,5-triazin-2-yl)phenol is sourced from PubChem (CID 146455664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).