3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid

C8H5FN2O2 — CID 146457225

IUPAC3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid
SMILESO=C(O)c1cccn2ncc(F)c12
InChIInChI=1S/C8H5FN2O2/c9-6-4-10-11-3-1-2-5(7(6)11)8(12)13/h1-4H,(H,12,13)
InChIKeyXIODTGWZUJKQPH-UHFFFAOYSA-N
MW180.14 g/mol
LogP1.17
Rot. Bonds1

About 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid

3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid (PubChem CID 146457225) has the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. Its IUPAC name is 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid.

Molecular Properties

Compound Name3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid
PubChem CID146457225
Molecular FormulaC8H5FN2O2
Molecular Weight180.14 g/mol
Exact Mass180.03
IUPAC Name3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid
SMILESO=C(O)c1cccn2ncc(F)c12
InChIInChI=1S/C8H5FN2O2/c9-6-4-10-11-3-1-2-5(7(6)11)8(12)13/h1-4H,(H,12,13)
InChIKeyXIODTGWZUJKQPH-UHFFFAOYSA-N
XLogP1.17
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.14
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid?
The IUPAC name of 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid (CID 146457225) is 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid.
What is the SMILES notation for 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid?
The canonical SMILES for 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid is O=C(O)c1cccn2ncc(F)c12.
What is the InChIKey of 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid?
The InChIKey is XIODTGWZUJKQPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN2O2/c9-6-4-10-11-3-1-2-5(7(6)11)8(12)13/h1-4H,(H,12,13).
What are the key properties of 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid?
3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid has a molecular weight of 180.14 g/mol, XLogP of 1.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropyrazolo[1,5-a]pyridine-4-carboxylic acid is sourced from PubChem (CID 146457225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).