C15H14F3N3O5S — CID 146457360
(7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylic acid (PubChem CID 146457360) has the molecular formula C15H14F3N3O5S and a molecular weight of 405.35 g/mol. Its IUPAC name is (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylic acid.
| Compound Name | (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 146457360 |
| Molecular Formula | C15H14F3N3O5S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (7S)-7-methyl-2-phenyl-3-(trifluoromethylsulfonyloxy)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridine-6-carboxylic acid |
| SMILES | C[C@H]1c2nn(-c3ccccc3)c(OS(=O)(=O)C(F)(F)F)c2CCN1C(=O)O |
| InChI | InChI=1S/C15H14F3N3O5S/c1-9-12-11(7-8-20(9)14(22)23)13(26-27(24,25)15(16,17)18)21(19-12)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,22,23)/t9-/m0/s1 |
| InChIKey | ZTQWBYACPZSBEJ-VIFPVBQESA-N |
| XLogP | 2.70 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|