C23H19F4N5O — CID 146457447
[(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(7-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)methanone (PubChem CID 146457447) has the molecular formula C23H19F4N5O and a molecular weight of 457.43 g/mol. Its IUPAC name is [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(7-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)methanone.
| Compound Name | [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(7-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 146457447 |
| Molecular Formula | C23H19F4N5O |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [(7S)-2,7-dimethyl-3-(3,4,5-trifluorophenyl)-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-6-yl]-(7-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)methanone |
| SMILES | Cc1nc2cc(F)ccn2c1C(=O)N1CCc2c(nn(C)c2-c2cc(F)c(F)c(F)c2)[C@@H]1C |
| InChI | InChI=1S/C23H19F4N5O/c1-11-21(32-6-4-14(24)10-18(32)28-11)23(33)31-7-5-15-20(12(31)2)29-30(3)22(15)13-8-16(25)19(27)17(26)9-13/h4,6,8-10,12H,5,7H2,1-3H3/t12-/m0/s1 |
| InChIKey | FUSHQRRKCQAEBU-LBPRGKRZSA-N |
| XLogP | 4.36 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|