C14H17FN6O5S — CID 146457490
N'-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 146457490) has the molecular formula C14H17FN6O5S and a molecular weight of 400.39 g/mol. Its IUPAC name is N'-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 146457490 |
| Molecular Formula | C14H17FN6O5S |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N'-[(1S)-6-fluoro-2,3-dihydro-1H-inden-1-yl]-N-hydroxy-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCOc1nonc1/C(=N/[C@H]1CCc2ccc(F)cc21)NO |
| InChI | InChI=1S/C14H17FN6O5S/c15-9-3-1-8-2-4-11(10(8)7-9)18-13(19-22)12-14(21-26-20-12)25-6-5-17-27(16,23)24/h1,3,7,11,17,22H,2,4-6H2,(H,18,19)(H2,16,23,24)/t11-/m0/s1 |
| InChIKey | CKQPHNIFWWVZTA-NSHDSACASA-N |
| XLogP | -0.21 |
| TPSA | 164.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|