C19H16BrF2N3O5S — CID 146458145
3-N-(4-bromo-2-nitrophenyl)-5-(2,4-difluorophenyl)benzene-1,3-diamine;methanesulfonic acid (PubChem CID 146458145) has the molecular formula C19H16BrF2N3O5S and a molecular weight of 516.32 g/mol. Its IUPAC name is 3-N-(4-bromo-2-nitrophenyl)-5-(2,4-difluorophenyl)benzene-1,3-diamine;methanesulfonic acid.
| Compound Name | 3-N-(4-bromo-2-nitrophenyl)-5-(2,4-difluorophenyl)benzene-1,3-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 146458145 |
| Molecular Formula | C19H16BrF2N3O5S |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 515.00 |
| IUPAC Name | 3-N-(4-bromo-2-nitrophenyl)-5-(2,4-difluorophenyl)benzene-1,3-diamine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Nc1cc(Nc2ccc(Br)cc2[N+](=O)[O-])cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H12BrF2N3O2.CH4O3S/c19-11-1-4-17(18(7-11)24(25)26)23-14-6-10(5-13(22)9-14)15-3-2-12(20)8-16(15)21;1-5(2,3)4/h1-9,23H,22H2;1H3,(H,2,3,4) |
| InChIKey | XZKOSLLFCXVPNE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|