C23H25N5O2 — CID 146458365
1-[4-[5-[(2-methoxyphenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]phenyl]-N,N-dimethylmethanamine oxide (PubChem CID 146458365) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[4-[5-[(2-methoxyphenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]phenyl]-N,N-dimethylmethanamine oxide.
| Compound Name | 1-[4-[5-[(2-methoxyphenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]phenyl]-N,N-dimethylmethanamine oxide |
|---|---|
| PubChem CID | 146458365 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[4-[5-[(2-methoxyphenyl)methylamino]-[1,2,4]triazolo[4,3-a]pyridin-8-yl]phenyl]-N,N-dimethylmethanamine oxide |
| SMILES | COc1ccccc1CNc1ccc(-c2ccc(C[N+](C)(C)[O-])cc2)c2nncn12 |
| InChI | InChI=1S/C23H25N5O2/c1-28(2,29)15-17-8-10-18(11-9-17)20-12-13-22(27-16-25-26-23(20)27)24-14-19-6-4-5-7-21(19)30-3/h4-13,16,24H,14-15H2,1-3H3 |
| InChIKey | MGLPZZYHNMFGLB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|