C25H19BrClF2N3O4S — CID 146458595
7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-1-[[(4S)-2-phenyl-1,3-dioxolan-4-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide (PubChem CID 146458595) has the molecular formula C25H19BrClF2N3O4S and a molecular weight of 610.86 g/mol. Its IUPAC name is 7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-1-[[(4S)-2-phenyl-1,3-dioxolan-4-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide.
| Compound Name | 7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-1-[[(4S)-2-phenyl-1,3-dioxolan-4-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146458595 |
| Molecular Formula | C25H19BrClF2N3O4S |
| Molecular Weight | 610.86 g/mol |
| Exact Mass | 608.99 |
| IUPAC Name | 7-bromo-N-[4-[chloro(difluoro)methoxy]phenyl]-1-[[(4S)-2-phenyl-1,3-dioxolan-4-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1cc(Br)c2c(c1)[nH]c(=S)n2C[C@H]1COC(c2ccccc2)O1 |
| InChI | InChI=1S/C25H19BrClF2N3O4S/c26-19-10-15(22(33)30-16-6-8-17(9-7-16)36-25(27,28)29)11-20-21(19)32(24(37)31-20)12-18-13-34-23(35-18)14-4-2-1-3-5-14/h1-11,18,23H,12-13H2,(H,30,33)(H,31,37)/t18-,23?/m0/s1 |
| InChIKey | ZSXVWZTXHRPQPP-XNUZUHMRSA-N |
| XLogP | 7.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.86 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|