C46H37FN6O2S — CID 146458911
3-[[6-(1-benzothiophen-2-yl)-5-fluoro-2-(5-tritylpyrrolo[2,3-b]pyrazin-7-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 146458911) has the molecular formula C46H37FN6O2S and a molecular weight of 756.91 g/mol. Its IUPAC name is 3-[[6-(1-benzothiophen-2-yl)-5-fluoro-2-(5-tritylpyrrolo[2,3-b]pyrazin-7-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | 3-[[6-(1-benzothiophen-2-yl)-5-fluoro-2-(5-tritylpyrrolo[2,3-b]pyrazin-7-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 146458911 |
| Molecular Formula | C46H37FN6O2S |
| Molecular Weight | 756.91 g/mol |
| Exact Mass | 756.27 |
| IUPAC Name | 3-[[6-(1-benzothiophen-2-yl)-5-fluoro-2-(5-tritylpyrrolo[2,3-b]pyrazin-7-yl)pyrimidin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | O=C(O)C1C2CCC(CC2)C1Nc1nc(-c2cn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3nccnc23)nc(-c2cc3ccccc3s2)c1F |
| InChI | InChI=1S/C46H37FN6O2S/c47-38-41(36-26-30-12-10-11-19-35(30)56-36)51-42(52-43(38)50-39-29-22-20-28(21-23-29)37(39)45(54)55)34-27-53(44-40(34)48-24-25-49-44)46(31-13-4-1-5-14-31,32-15-6-2-7-16-32)33-17-8-3-9-18-33/h1-19,24-29,37,39H,20-23H2,(H,54,55)(H,50,51,52) |
| InChIKey | SLONQPUTMAAXPD-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.91 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|