C19H23NO2 — CID 146459397
2-(dimethylaminomethylidene)-5-(5,6,7,8-tetrahydronaphthalen-1-yl)cyclohexane-1,3-dione (PubChem CID 146459397) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(dimethylaminomethylidene)-5-(5,6,7,8-tetrahydronaphthalen-1-yl)cyclohexane-1,3-dione.
| Compound Name | 2-(dimethylaminomethylidene)-5-(5,6,7,8-tetrahydronaphthalen-1-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 146459397 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(dimethylaminomethylidene)-5-(5,6,7,8-tetrahydronaphthalen-1-yl)cyclohexane-1,3-dione |
| SMILES | CN(C)C=C1C(=O)CC(c2cccc3c2CCCC3)CC1=O |
| InChI | InChI=1S/C19H23NO2/c1-20(2)12-17-18(21)10-14(11-19(17)22)16-9-5-7-13-6-3-4-8-15(13)16/h5,7,9,12,14H,3-4,6,8,10-11H2,1-2H3/b17-12- |
| InChIKey | BRJQCPQUGVOEAW-ATVHPVEESA-N |
| XLogP | 3.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|