About 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one
5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 146459550) has the molecular formula C17H20Cl2N2O2
and a molecular weight of 355.27 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one |
| PubChem CID | 146459550 |
| Molecular Formula | C17H20Cl2N2O2 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CN(C)CC/N=C/C1=C(O)CC(c2ccc(Cl)cc2Cl)CC1=O |
| InChI | InChI=1S/C17H20Cl2N2O2/c1-21(2)6-5-20-10-14-16(22)7-11(8-17(14)23)13-4-3-12(18)9-15(13)19/h3-4,9-11,22H,5-8H2,1-2H3/b20-10+ |
| InChIKey | CKBHJVXZUOTUKL-KEBDBYFISA-N |
| XLogP | 3.88 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one?
The IUPAC name of 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one (CID 146459550) is 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one?
The canonical SMILES for 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one is CN(C)CC/N=C/C1=C(O)CC(c2ccc(Cl)cc2Cl)CC1=O.
What is the InChIKey of 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one?
The InChIKey is CKBHJVXZUOTUKL-KEBDBYFISA-N. The full InChI is InChI=1S/C17H20Cl2N2O2/c1-21(2)6-5-20-10-14-16(22)7-11(8-17(14)23)13-4-3-12(18)9-15(13)19/h3-4,9-11,22H,5-8H2,1-2H3/b20-10+.
What are the key properties of 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one?
5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one has a molecular weight of 355.27 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-2-[2-(dimethylamino)ethyliminomethyl]-3-hydroxycyclohex-2-en-1-one is sourced from PubChem (CID 146459550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).