C16H9ClO5 — CID 146460580
8-chloro-2-(6-hydroxy-1,3-benzodioxol-5-yl)chromen-4-one (PubChem CID 146460580) has the molecular formula C16H9ClO5 and a molecular weight of 316.70 g/mol. Its IUPAC name is 8-chloro-2-(6-hydroxy-1,3-benzodioxol-5-yl)chromen-4-one.
| Compound Name | 8-chloro-2-(6-hydroxy-1,3-benzodioxol-5-yl)chromen-4-one |
|---|---|
| PubChem CID | 146460580 |
| Molecular Formula | C16H9ClO5 |
| Molecular Weight | 316.70 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 8-chloro-2-(6-hydroxy-1,3-benzodioxol-5-yl)chromen-4-one |
| SMILES | O=c1cc(-c2cc3c(cc2O)OCO3)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C16H9ClO5/c17-10-3-1-2-8-11(18)5-13(22-16(8)10)9-4-14-15(6-12(9)19)21-7-20-14/h1-6,19H,7H2 |
| InChIKey | YBFPKUJRGHOALZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |