About 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile
3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile (PubChem CID 14646136) has the molecular formula C13H11N3O2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile |
| PubChem CID | 14646136 |
| Molecular Formula | C13H11N3O2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile |
| SMILES | Cc1nc(C#N)c(S(=O)(=O)c2ccccc2)nc1C |
| InChI | InChI=1S/C13H11N3O2S/c1-9-10(2)16-13(12(8-14)15-9)19(17,18)11-6-4-3-5-7-11/h3-7H,1-2H3 |
| InChIKey | WXMBFXWRTOPTDH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile?
The IUPAC name of 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile (CID 14646136) is 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile.
What is the SMILES notation for 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile?
The canonical SMILES for 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile is Cc1nc(C#N)c(S(=O)(=O)c2ccccc2)nc1C.
What is the InChIKey of 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile?
The InChIKey is WXMBFXWRTOPTDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O2S/c1-9-10(2)16-13(12(8-14)15-9)19(17,18)11-6-4-3-5-7-11/h3-7H,1-2H3.
What are the key properties of 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile?
3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile has a molecular weight of 273.32 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-5,6-dimethylpyrazine-2-carbonitrile is sourced from PubChem (CID 14646136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).