C34H37Cl2N9O4 — CID 146462117
2-butan-2-yl-4-[6-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-1,2,4-triazol-3-one (PubChem CID 146462117) has the molecular formula C34H37Cl2N9O4 and a molecular weight of 706.64 g/mol. Its IUPAC name is 2-butan-2-yl-4-[6-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[6-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 146462117 |
| Molecular Formula | C34H37Cl2N9O4 |
| Molecular Weight | 706.64 g/mol |
| Exact Mass | 705.23 |
| IUPAC Name | 2-butan-2-yl-4-[6-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]-3-pyridinyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@](Cn6cncn6)(c6ccc(Cl)cc6Cl)O5)cc4)CC3)nc2)c1=O |
| InChI | InChI=1S/C34H37Cl2N9O4/c1-3-24(2)45-33(46)44(23-40-45)27-7-11-32(38-17-27)42-14-12-41(13-15-42)26-5-8-28(9-6-26)47-18-29-19-48-34(49-29,20-43-22-37-21-39-43)30-10-4-25(35)16-31(30)36/h4-11,16-17,21-24,29H,3,12-15,18-20H2,1-2H3/t24?,29-,34-/m1/s1 |
| InChIKey | BSGWFGZUNUZUHU-ZAYNPTSRSA-N |
| XLogP | 4.97 |
| TPSA | 117.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|