C25H35F2N3O4 — CID 146462161
2-[(3,3-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462161) has the molecular formula C25H35F2N3O4 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[(3,3-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462161 |
| Molecular Formula | C25H35F2N3O4 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-[(3,3-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | O=C(NC(CCOC1CC(CCc2ccc3c(n2)NCCC3)C1)C(=O)O)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C25H35F2N3O4/c26-25(27)10-1-3-18(15-25)23(31)30-21(24(32)33)9-12-34-20-13-16(14-20)5-7-19-8-6-17-4-2-11-28-22(17)29-19/h6,8,16,18,20-21H,1-5,7,9-15H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | NFUYCRGIELRHBJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |