C27H39N3O5 — CID 146462198
(2S)-2-[[1-(oxan-2-yl)cyclopropanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462198) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is (2S)-2-[[1-(oxan-2-yl)cyclopropanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | (2S)-2-[[1-(oxan-2-yl)cyclopropanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462198 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (2S)-2-[[1-(oxan-2-yl)cyclopropanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | O=C(O)[C@H](CCOC1CC(CCc2ccc3c(n2)NCCC3)C1)NC(=O)C1(C2CCCCO2)CC1 |
| InChI | InChI=1S/C27H39N3O5/c31-25(32)22(30-26(33)27(11-12-27)23-5-1-2-14-35-23)10-15-34-21-16-18(17-21)6-8-20-9-7-19-4-3-13-28-24(19)29-20/h7,9,18,21-23H,1-6,8,10-17H2,(H,28,29)(H,30,33)(H,31,32)/t18?,21?,22-,23?/m0/s1 |
| InChIKey | JGMNBQOEOAAHIY-KJYDKAEJSA-N |
| XLogP | 3.48 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |