C33H45N3O4 — CID 146462221
2-[[1-(4-tert-butylphenyl)cyclobutanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462221) has the molecular formula C33H45N3O4 and a molecular weight of 547.74 g/mol. Its IUPAC name is 2-[[1-(4-tert-butylphenyl)cyclobutanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[[1-(4-tert-butylphenyl)cyclobutanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462221 |
| Molecular Formula | C33H45N3O4 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | 2-[[1-(4-tert-butylphenyl)cyclobutanecarbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | CC(C)(C)c1ccc(C2(C(=O)NC(CCOC3CC(CCc4ccc5c(n4)NCCC5)C3)C(=O)O)CCC2)cc1 |
| InChI | InChI=1S/C33H45N3O4/c1-32(2,3)24-9-11-25(12-10-24)33(16-5-17-33)31(39)36-28(30(37)38)15-19-40-27-20-22(21-27)7-13-26-14-8-23-6-4-18-34-29(23)35-26/h8-12,14,22,27-28H,4-7,13,15-21H2,1-3H3,(H,34,35)(H,36,39)(H,37,38) |
| InChIKey | RGHIQLCNYVHEMN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |