C27H33N5O3 — CID 146462268
2-[(7-methylquinazolin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462268) has the molecular formula C27H33N5O3 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[(7-methylquinazolin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[(7-methylquinazolin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462268 |
| Molecular Formula | C27H33N5O3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | 2-[(7-methylquinazolin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | Cc1ccc2c(NC(CCOC3CC(CCc4ccc5c(n4)NCCC5)C3)C(=O)O)ncnc2c1 |
| InChI | InChI=1S/C27H33N5O3/c1-17-4-9-22-24(13-17)29-16-30-26(22)32-23(27(33)34)10-12-35-21-14-18(15-21)5-7-20-8-6-19-3-2-11-28-25(19)31-20/h4,6,8-9,13,16,18,21,23H,2-3,5,7,10-12,14-15H2,1H3,(H,28,31)(H,33,34)(H,29,30,32) |
| InChIKey | OMRZSYULRZMEAN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |