C28H36FN3O4 — CID 146462340
2-[[2-(4-fluorophenyl)-2-methylpropanoyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462340) has the molecular formula C28H36FN3O4 and a molecular weight of 497.61 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenyl)-2-methylpropanoyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[[2-(4-fluorophenyl)-2-methylpropanoyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462340 |
| Molecular Formula | C28H36FN3O4 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | 2-[[2-(4-fluorophenyl)-2-methylpropanoyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | CC(C)(C(=O)NC(CCOC1CC(CCc2ccc3c(n2)NCCC3)C1)C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H36FN3O4/c1-28(2,20-7-9-21(29)10-8-20)27(35)32-24(26(33)34)13-15-36-23-16-18(17-23)5-11-22-12-6-19-4-3-14-30-25(19)31-22/h6-10,12,18,23-24H,3-5,11,13-17H2,1-2H3,(H,30,31)(H,32,35)(H,33,34) |
| InChIKey | RFLGKGLDZIKHPW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |