C24H34F3N3O4 — CID 146462436
(2S)-2-[(2-ethyl-4,4,4-trifluorobutanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462436) has the molecular formula C24H34F3N3O4 and a molecular weight of 485.55 g/mol. Its IUPAC name is (2S)-2-[(2-ethyl-4,4,4-trifluorobutanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | (2S)-2-[(2-ethyl-4,4,4-trifluorobutanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462436 |
| Molecular Formula | C24H34F3N3O4 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (2S)-2-[(2-ethyl-4,4,4-trifluorobutanoyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | CCC(CC(F)(F)F)C(=O)N[C@@H](CCOC1CC(CCc2ccc3c(n2)NCCC3)C1)C(=O)O |
| InChI | InChI=1S/C24H34F3N3O4/c1-2-16(14-24(25,26)27)22(31)30-20(23(32)33)9-11-34-19-12-15(13-19)5-7-18-8-6-17-4-3-10-28-21(17)29-18/h6,8,15-16,19-20H,2-5,7,9-14H2,1H3,(H,28,29)(H,30,31)(H,32,33)/t15?,16?,19?,20-/m0/s1 |
| InChIKey | USJVHWVZJRVZSF-RTJZXMOCSA-N |
| XLogP | 4.11 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |