C26H37N5O3 — CID 146462461
2-[(2-tert-butylpyrimidin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462461) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-[(2-tert-butylpyrimidin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[(2-tert-butylpyrimidin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462461 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 2-[(2-tert-butylpyrimidin-4-yl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | CC(C)(C)c1nccc(NC(CCOC2CC(CCc3ccc4c(n3)NCCC4)C2)C(=O)O)n1 |
| InChI | InChI=1S/C26H37N5O3/c1-26(2,3)25-28-13-10-22(31-25)30-21(24(32)33)11-14-34-20-15-17(16-20)6-8-19-9-7-18-5-4-12-27-23(18)29-19/h7,9-10,13,17,20-21H,4-6,8,11-12,14-16H2,1-3H3,(H,27,29)(H,32,33)(H,28,30,31) |
| InChIKey | YTUBRUYVLQQKJN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |