C27H39F2N3O4 — CID 146462476
2-[(1-ethyl-4,4-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462476) has the molecular formula C27H39F2N3O4 and a molecular weight of 507.62 g/mol. Its IUPAC name is 2-[(1-ethyl-4,4-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | 2-[(1-ethyl-4,4-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462476 |
| Molecular Formula | C27H39F2N3O4 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 2-[(1-ethyl-4,4-difluorocyclohexanecarbonyl)amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | CCC1(C(=O)NC(CCOC2CC(CCc3ccc4c(n3)NCCC4)C2)C(=O)O)CCC(F)(F)CC1 |
| InChI | InChI=1S/C27H39F2N3O4/c1-2-26(10-12-27(28,29)13-11-26)25(35)32-22(24(33)34)9-15-36-21-16-18(17-21)5-7-20-8-6-19-4-3-14-30-23(19)31-20/h6,8,18,21-22H,2-5,7,9-17H2,1H3,(H,30,31)(H,32,35)(H,33,34) |
| InChIKey | YTGQZBADLMECJC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |