C23H33F2N3O4 — CID 146462561
2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 146462561) has the molecular formula C23H33F2N3O4 and a molecular weight of 453.53 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | 2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 146462561 |
| Molecular Formula | C23H33F2N3O4 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-[(4,4-difluorocyclohexanecarbonyl)amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | O=C(NC(CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C23H33F2N3O4/c24-23(25)11-8-17(9-12-23)21(29)28-19(22(30)31)10-15-32-14-2-1-5-18-7-6-16-4-3-13-26-20(16)27-18/h6-7,17,19H,1-5,8-15H2,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | UQACIOIEDMHDQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|