C27H37N5O4 — CID 146462676
(2S)-2-[[(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid (PubChem CID 146462676) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is (2S)-2-[[(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid.
| Compound Name | (2S)-2-[[(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
|---|---|
| PubChem CID | 146462676 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (2S)-2-[[(6R)-1-methyl-4,5,6,7-tetrahydroindazole-6-carbonyl]amino]-4-[3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]cyclobutyl]oxybutanoic acid |
| SMILES | Cn1ncc2c1C[C@H](C(=O)N[C@@H](CCOC1CC(CCc3ccc4c(n3)NCCC4)C1)C(=O)O)CC2 |
| InChI | InChI=1S/C27H37N5O4/c1-32-24-15-19(5-6-20(24)16-29-32)26(33)31-23(27(34)35)10-12-36-22-13-17(14-22)4-8-21-9-7-18-3-2-11-28-25(18)30-21/h7,9,16-17,19,22-23H,2-6,8,10-15H2,1H3,(H,28,30)(H,31,33)(H,34,35)/t17?,19-,22?,23+/m1/s1 |
| InChIKey | BNTLEQQJLFKSLZ-GSFMUVBGSA-N |
| XLogP | 2.67 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |