C23H24ClFN4O5 — CID 146462753
methyl 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(1,8-naphthyridin-2-yl)butoxy]butanoate (PubChem CID 146462753) has the molecular formula C23H24ClFN4O5 and a molecular weight of 490.92 g/mol. Its IUPAC name is methyl 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(1,8-naphthyridin-2-yl)butoxy]butanoate.
| Compound Name | methyl 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(1,8-naphthyridin-2-yl)butoxy]butanoate |
|---|---|
| PubChem CID | 146462753 |
| Molecular Formula | C23H24ClFN4O5 |
| Molecular Weight | 490.92 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | methyl 2-[(3-chloro-5-fluoropyridine-4-carbonyl)amino]-4-[(2S)-2-hydroxy-4-(1,8-naphthyridin-2-yl)butoxy]butanoate |
| SMILES | COC(=O)C(CCOC[C@@H](O)CCc1ccc2cccnc2n1)NC(=O)c1c(F)cncc1Cl |
| InChI | InChI=1S/C23H24ClFN4O5/c1-33-23(32)19(29-22(31)20-17(24)11-26-12-18(20)25)8-10-34-13-16(30)7-6-15-5-4-14-3-2-9-27-21(14)28-15/h2-5,9,11-12,16,19,30H,6-8,10,13H2,1H3,(H,29,31)/t16-,19?/m0/s1 |
| InChIKey | MBKHSDSNSHGKFK-UCFFOFKASA-N |
| XLogP | 2.49 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.92 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|