About (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal
(20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal (PubChem CID 146462909) has the molecular formula C34H65NO
and a molecular weight of 503.90 g/mol. Its IUPAC name is (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal.
Molecular Properties
| Compound Name | (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal |
| PubChem CID | 146462909 |
| Molecular Formula | C34H65NO |
| Molecular Weight | 503.90 g/mol |
| Exact Mass | 503.51 |
| IUPAC Name | (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC=O)CCCN(C)C |
| InChI | InChI=1S/C34H65NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25-29-34(31-28-32-35(2)3)30-26-23-20-18-21-24-27-33-36/h8-9,11-12,33-34H,4-7,10,13-32H2,1-3H3/b9-8-,12-11- |
| InChIKey | JBPAWNCPLILHDY-MURFETPASA-N |
| XLogP | 10.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.90 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal?
The IUPAC name of (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal (CID 146462909) is (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal.
What is the SMILES notation for (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal?
The canonical SMILES for (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal is CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC=O)CCCN(C)C.
What is the InChIKey of (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal?
The InChIKey is JBPAWNCPLILHDY-MURFETPASA-N. The full InChI is InChI=1S/C34H65NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25-29-34(31-28-32-35(2)3)30-26-23-20-18-21-24-27-33-36/h8-9,11-12,33-34H,4-7,10,13-32H2,1-3H3/b9-8-,12-11-.
What are the key properties of (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal?
(20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal has a molecular weight of 503.90 g/mol, XLogP of 10.86, 29 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienal is sourced from PubChem (CID 146462909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).