C26H31FN6O3 — CID 146463259
(1,3,3-trimethylpiperidin-4-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate (PubChem CID 146463259) has the molecular formula C26H31FN6O3 and a molecular weight of 494.57 g/mol. Its IUPAC name is (1,3,3-trimethylpiperidin-4-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate.
| Compound Name | (1,3,3-trimethylpiperidin-4-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 146463259 |
| Molecular Formula | C26H31FN6O3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | (1,3,3-trimethylpiperidin-4-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4CCN(C)CC4(C)C)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C26H31FN6O3/c1-14-17(11-31-24-23(14)29-6-8-35-24)16-9-15-10-20(30-12-18(15)22(28)21(16)27)32-25(34)36-19-5-7-33(4)13-26(19,2)3/h9-12,19,29H,5-8,13,28H2,1-4H3,(H,30,32,34) |
| InChIKey | YUUGXGGJHQLHHT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|