C25H30FN7O3 — CID 146463772
(1,4-dimethyl-1,4-diazepan-6-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate (PubChem CID 146463772) has the molecular formula C25H30FN7O3 and a molecular weight of 495.56 g/mol. Its IUPAC name is (1,4-dimethyl-1,4-diazepan-6-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate.
| Compound Name | (1,4-dimethyl-1,4-diazepan-6-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 146463772 |
| Molecular Formula | C25H30FN7O3 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (1,4-dimethyl-1,4-diazepan-6-yl) N-[8-amino-7-fluoro-6-(8-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazin-7-yl)isoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4CN(C)CCN(C)C4)ncc3c(N)c2F)cnc2c1NCCO2 |
| InChI | InChI=1S/C25H30FN7O3/c1-14-18(10-30-24-23(14)28-4-7-35-24)17-8-15-9-20(29-11-19(15)22(27)21(17)26)31-25(34)36-16-12-32(2)5-6-33(3)13-16/h8-11,16,28H,4-7,12-13,27H2,1-3H3,(H,29,31,34) |
| InChIKey | GETBGYVHBPDCBB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|