C24H26FN5O4S — CID 146463858
(1,1-dioxothian-4-yl) N-[8-amino-7-fluoro-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-3-yl]carbamate (PubChem CID 146463858) has the molecular formula C24H26FN5O4S and a molecular weight of 499.57 g/mol. Its IUPAC name is (1,1-dioxothian-4-yl) N-[8-amino-7-fluoro-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-3-yl]carbamate.
| Compound Name | (1,1-dioxothian-4-yl) N-[8-amino-7-fluoro-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 146463858 |
| Molecular Formula | C24H26FN5O4S |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (1,1-dioxothian-4-yl) N-[8-amino-7-fluoro-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)isoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4CCS(=O)(=O)CC4)ncc3c(N)c2F)cnc2c1NCCC2 |
| InChI | InChI=1S/C24H26FN5O4S/c1-13-17(11-28-19-3-2-6-27-23(13)19)16-9-14-10-20(29-12-18(14)22(26)21(16)25)30-24(31)34-15-4-7-35(32,33)8-5-15/h9-12,15,27H,2-8,26H2,1H3,(H,29,30,31) |
| InChIKey | ZGRMYNDLZIWUKF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|