C12H12BrNO — CID 146464452
(1S,5S,6S)-6-(bromomethyl)-3-phenyl-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 146464452) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is (1S,5S,6S)-6-(bromomethyl)-3-phenyl-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5S,6S)-6-(bromomethyl)-3-phenyl-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 146464452 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (1S,5S,6S)-6-(bromomethyl)-3-phenyl-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | O=C1[C@H]2[C@H](CN1c1ccccc1)[C@@H]2CBr |
| InChI | InChI=1S/C12H12BrNO/c13-6-9-10-7-14(12(15)11(9)10)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2/t9-,10+,11+/m0/s1 |
| InChIKey | VKEBAWSFXVEEHA-HBNTYKKESA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|