C22H24BrNO5 — CID 146464609
2-[[(3R)-1-(3-bromo-2-ethoxybenzoyl)piperidin-3-yl]methoxy]-6-hydroxybenzaldehyde (PubChem CID 146464609) has the molecular formula C22H24BrNO5 and a molecular weight of 462.34 g/mol. Its IUPAC name is 2-[[(3R)-1-(3-bromo-2-ethoxybenzoyl)piperidin-3-yl]methoxy]-6-hydroxybenzaldehyde.
| Compound Name | 2-[[(3R)-1-(3-bromo-2-ethoxybenzoyl)piperidin-3-yl]methoxy]-6-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 146464609 |
| Molecular Formula | C22H24BrNO5 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[[(3R)-1-(3-bromo-2-ethoxybenzoyl)piperidin-3-yl]methoxy]-6-hydroxybenzaldehyde |
| SMILES | CCOc1c(Br)cccc1C(=O)N1CCC[C@@H](COc2cccc(O)c2C=O)C1 |
| InChI | InChI=1S/C22H24BrNO5/c1-2-28-21-16(7-3-8-18(21)23)22(27)24-11-5-6-15(12-24)14-29-20-10-4-9-19(26)17(20)13-25/h3-4,7-10,13,15,26H,2,5-6,11-12,14H2,1H3/t15-/m1/s1 |
| InChIKey | LZDRXGDURBTKPG-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|