C25H28FN5O3 — CID 146464986
oxan-4-yl N-[8-amino-6-[(8S)-4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl]-7-fluoroisoquinolin-3-yl]carbamate (PubChem CID 146464986) has the molecular formula C25H28FN5O3 and a molecular weight of 465.53 g/mol. Its IUPAC name is oxan-4-yl N-[8-amino-6-[(8S)-4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl]-7-fluoroisoquinolin-3-yl]carbamate.
| Compound Name | oxan-4-yl N-[8-amino-6-[(8S)-4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl]-7-fluoroisoquinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 146464986 |
| Molecular Formula | C25H28FN5O3 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | oxan-4-yl N-[8-amino-6-[(8S)-4,8-dimethyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl]-7-fluoroisoquinolin-3-yl]carbamate |
| SMILES | Cc1c(-c2cc3cc(NC(=O)OC4CCOCC4)ncc3c(N)c2F)cnc2c1NCC[C@@H]2C |
| InChI | InChI=1S/C25H28FN5O3/c1-13-3-6-28-24-14(2)18(11-30-23(13)24)17-9-15-10-20(29-12-19(15)22(27)21(17)26)31-25(32)34-16-4-7-33-8-5-16/h9-13,16,28H,3-8,27H2,1-2H3,(H,29,31,32)/t13-/m0/s1 |
| InChIKey | LCNRODQZSVOSDX-ZDUSSCGKSA-N |
| XLogP | 4.97 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|