About 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene
2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene (PubChem CID 146465575) has the molecular formula C17H21NO3
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene.
Molecular Properties
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene |
| PubChem CID | 146465575 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.NC(CO)(CO)CO |
| InChI | InChI=1S/C13H10.C4H11NO3/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;5-4(1-6,2-7)3-8/h1-8H,9H2;6-8H,1-3,5H2 |
| InChIKey | XOHBDPPIXNNNMN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene?
The IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene (CID 146465575) is 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene.
What is the SMILES notation for 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene?
The canonical SMILES for 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.NC(CO)(CO)CO.
What is the InChIKey of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene?
The InChIKey is XOHBDPPIXNNNMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C4H11NO3/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;5-4(1-6,2-7)3-8/h1-8H,9H2;6-8H,1-3,5H2.
What are the key properties of 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene?
2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene has a molecular weight of 287.36 g/mol, XLogP of 1.07, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(hydroxymethyl)propane-1,3-diol;1H-phenalene is sourced from PubChem (CID 146465575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).