C15H21FN4O3 — CID 146466296
(2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 146466296) has the molecular formula C15H21FN4O3 and a molecular weight of 324.36 g/mol. Its IUPAC name is (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146466296 |
| Molecular Formula | C15H21FN4O3 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2S,5R)-4-[1-(4-fluorophenyl)-2-hydrazinyl-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)[C@@H](C)CN1C(C(=O)NN)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN4O3/c1-9-8-20(15(22)23)10(2)7-19(9)13(14(21)18-17)11-3-5-12(16)6-4-11/h3-6,9-10,13H,7-8,17H2,1-2H3,(H,18,21)(H,22,23)/t9-,10+,13?/m1/s1 |
| InChIKey | HJMIEJOKLUPCIU-GDVCOKDOSA-N |
| XLogP | 0.93 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|