C25H24FN7O2 — CID 146466838
8-[(2S,5R)-4-[(4-fluorophenyl)-(1,2,4-oxadiazol-5-yl)methyl]-2,5-dimethylpiperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile (PubChem CID 146466838) has the molecular formula C25H24FN7O2 and a molecular weight of 473.51 g/mol. Its IUPAC name is 8-[(2S,5R)-4-[(4-fluorophenyl)-(1,2,4-oxadiazol-5-yl)methyl]-2,5-dimethylpiperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile.
| Compound Name | 8-[(2S,5R)-4-[(4-fluorophenyl)-(1,2,4-oxadiazol-5-yl)methyl]-2,5-dimethylpiperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile |
|---|---|
| PubChem CID | 146466838 |
| Molecular Formula | C25H24FN7O2 |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 8-[(2S,5R)-4-[(4-fluorophenyl)-(1,2,4-oxadiazol-5-yl)methyl]-2,5-dimethylpiperazin-1-yl]-5-methyl-6-oxo-1,5-naphthyridine-2-carbonitrile |
| SMILES | C[C@@H]1CN(c2cc(=O)n(C)c3ccc(C#N)nc23)[C@@H](C)CN1C(c1ccc(F)cc1)c1ncno1 |
| InChI | InChI=1S/C25H24FN7O2/c1-15-13-33(24(25-28-14-29-35-25)17-4-6-18(26)7-5-17)16(2)12-32(15)21-10-22(34)31(3)20-9-8-19(11-27)30-23(20)21/h4-10,14-16,24H,12-13H2,1-3H3/t15-,16+,24?/m0/s1 |
| InChIKey | ZUVQZPAQWLYGMW-CAFRZEFWSA-N |
| XLogP | 3.02 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |