About sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate
sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate (PubChem CID 146467224) has the molecular formula C12H21N2NaO11S
and a molecular weight of 424.36 g/mol. Its IUPAC name is sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate.
Molecular Properties
| Compound Name | sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate |
| PubChem CID | 146467224 |
| Molecular Formula | C12H21N2NaO11S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate |
| SMILES | CCS(=O)(=O)[O-].O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Na+] |
| InChI | InChI=1S/C10H16N2O8.C2H6O3S.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2-6(3,4)5;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);2H2,1H3,(H,3,4,5);/q;;+1/p-1 |
| InChIKey | YIDKOFYETFYVJT-UHFFFAOYSA-M |
| XLogP | -5.52 |
| TPSA | 212.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | -5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate?
The IUPAC name of sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate (CID 146467224) is sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate.
What is the SMILES notation for sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate?
The canonical SMILES for sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate is CCS(=O)(=O)[O-].O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.[Na+].
What is the InChIKey of sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate?
The InChIKey is YIDKOFYETFYVJT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N2O8.C2H6O3S.Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;1-2-6(3,4)5;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);2H2,1H3,(H,3,4,5);/q;;+1/p-1.
What are the key properties of sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate?
sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate has a molecular weight of 424.36 g/mol, XLogP of -5.52, 12 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;ethanesulfonate is sourced from PubChem (CID 146467224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).