C27H30FN9O2 — CID 146467316
5-[2-[4-(2-fluoro-4-pyrrolidin-3-yloxyphenyl)piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine (PubChem CID 146467316) has the molecular formula C27H30FN9O2 and a molecular weight of 531.60 g/mol. Its IUPAC name is 5-[2-[4-(2-fluoro-4-pyrrolidin-3-yloxyphenyl)piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine.
| Compound Name | 5-[2-[4-(2-fluoro-4-pyrrolidin-3-yloxyphenyl)piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine |
|---|---|
| PubChem CID | 146467316 |
| Molecular Formula | C27H30FN9O2 |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 5-[2-[4-(2-fluoro-4-pyrrolidin-3-yloxyphenyl)piperazin-1-yl]ethyl]-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-8-amine |
| SMILES | Nc1nc2c(cnn2CCN2CCN(c3ccc(OC4CCNC4)cc3F)CC2)c2cc(-c3ccco3)nn12 |
| InChI | InChI=1S/C27H30FN9O2/c28-21-14-18(39-19-5-6-30-16-19)3-4-23(21)35-10-7-34(8-11-35)9-12-36-26-20(17-31-36)24-15-22(25-2-1-13-38-25)33-37(24)27(29)32-26/h1-4,13-15,17,19,30H,5-12,16H2,(H2,29,32) |
| InChIKey | PRJIPQRZGULQDO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|