C27H31FN10O3 — CID 146467373
2-[2-[4-[4-[2-[8-amino-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethylamino]acetamide (PubChem CID 146467373) has the molecular formula C27H31FN10O3 and a molecular weight of 562.61 g/mol. Its IUPAC name is 2-[2-[4-[4-[2-[8-amino-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethylamino]acetamide.
| Compound Name | 2-[2-[4-[4-[2-[8-amino-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethylamino]acetamide |
|---|---|
| PubChem CID | 146467373 |
| Molecular Formula | C27H31FN10O3 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 2-[2-[4-[4-[2-[8-amino-11-(furan-2-yl)-4,5,7,9,10-pentazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaen-5-yl]ethyl]piperazin-1-yl]-3-fluorophenoxy]ethylamino]acetamide |
| SMILES | NC(=O)CNCCOc1ccc(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)cc43)CC2)c(F)c1 |
| InChI | InChI=1S/C27H31FN10O3/c28-20-14-18(40-13-5-31-17-25(29)39)3-4-22(20)36-9-6-35(7-10-36)8-11-37-26-19(16-32-37)23-15-21(24-2-1-12-41-24)34-38(23)27(30)33-26/h1-4,12,14-16,31H,5-11,13,17H2,(H2,29,39)(H2,30,33) |
| InChIKey | CKIMTRQEMNZKGQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|