C27H31FN10O2 — CID 146467786
10-[2-[4-(2-fluoro-4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 146467786) has the molecular formula C27H31FN10O2 and a molecular weight of 546.61 g/mol. Its IUPAC name is 10-[2-[4-(2-fluoro-4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 10-[2-[4-(2-fluoro-4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 146467786 |
| Molecular Formula | C27H31FN10O2 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 10-[2-[4-(2-fluoro-4-piperidin-4-yloxyphenyl)piperazin-1-yl]ethyl]-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCN2CCN(c3ccc(OC4CCNCC4)cc3F)CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C27H31FN10O2/c28-21-16-19(40-18-5-7-30-8-6-18)3-4-22(21)36-12-9-35(10-13-36)11-14-37-25-20(17-31-37)26-32-24(23-2-1-15-39-23)34-38(26)27(29)33-25/h1-4,15-18,30H,5-14H2,(H2,29,33) |
| InChIKey | QWUHIRDZOVFQRR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|